This compound is a deuterated form of propan-2-amine, where all six hydrogen atoms on the two methyl groups are replaced with deuterium. It is primarily used as a research reagent in laboratories for isotope labeling and tracing studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
ISO-PROPYL-1,1,1,3,3,3-D6-AMINE 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N,N'-Diacetyl-L-cystine
analytical reference standard
Benzyl 2-amino-2-methylpropanoate
research compound
2-AMINO-4,6-DIHYDROXY-5-NITROSOPYRIMIDINE
Nitrosamine reference standard
3,4-Dimethylphenylboronic acid
boronic acid research reagent
2-Propanamine
Solvent and chemical intermediate
1,1,1,2,3,3,3-heptadeuteriopropan-2-amine
deuterated research compound
Iso-Propyl-d7-amine HCl
Research compound with deuterium labeling
1,1,1,3,3,3-hexadeuteriopropan-2-amine
JJWLVOIRVHMVIS-WFGJKAKNSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])N
ISO-PROPYL-1,1,1,3,3,3-D6-AMINE 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.