This compound is a deuterium-labeled form of isopropylamine hydrochloride, primarily used as a research reagent. The incorporation of seven deuterium atoms makes it valuable for tracing and analytical studies in chemical and biological research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Iso-Propyl-d7-amine HCl 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,1,1,2,3,3,3-heptadeuteriopropan-2-amine
deuterated research compound
(S)-Ru(OAc)2(T-BINAP)
chiral catalyst for asymmetric synthesis
Isopropylmagnesium Chloride
Grignard reagent for organic synthesis
Aminomalonic acid
metabolite research reagent
(S)-morpholine-3-carboxylic acid
research compound
ISO-PROPYL-1,1,1,3,3,3-D6-AMINE
deuterated research reagent
2-Propanamine
Solvent and chemical intermediate
1,1,1,2,3,3,3-heptadeuteriopropan-2-amine;hydrochloride
ISYORFGKSZLPNW-NDCOIKGTSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])N.Cl
Iso-Propyl-d7-amine HCl 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.