3-Bromo-2-nitropyridine is a pyridine derivative used as a research reagent. It features a pyridine ring substituted with bromine and nitro groups, contributing to its utility in chemical synthesis and laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-Bromo-2-nitropyridine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,3-Dinitrobenzene-d4
isotopically labeled reference standard
4-(Diethylamino)benzoic acid
research compound for peptide synthesis
Benzene-1,3-d2-2-bromo-5-methyl-(9CI)
research compound
Taurocyamine
Research compound for enzyme studies
3-bromo-2-nitropyridine
WFNISJZUJCKTLT-UHFFFAOYSA-N
C1=CC(=C(N=C1)[N+](=O)[O-])Br
3-Bromo-2-nitropyridine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.