This compound is a deuterated form of tert-butanol, where all hydrogen atoms in the methyl groups and the hydroxyl group are replaced with deuterium. It is primarily used as a pharmaceutical intermediate in the synthesis of deuterated active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Propan-1,1,1,3,3,3-d6-ol-d, 2-(methyl-d3)- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Amino-6-chloropyrimidine
Pharmaceutical intermediate
(2,3,4,5-tetrafluorophenyl)methanol
Pharmaceutical intermediate synthesis
1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (2S)-
Boc-protected amino acid intermediate
3-(4,5-Dihydro-1H-imidazol-2-yl)aniline monohydrochloride
pharmaceutical intermediate
Tert-Butanol
Solvent, denaturant, and gasoline additive
Zirconium(iv) t-butoxide
precursor for zirconium containing materials
2-Methyl-2-propan-d9-ol
Deuterated chemical intermediate for synthesis
2-Methylpropan-2-(2H)ol
Deuterated research reagent
2-Propan-1,1,1,3,3,3-d6-ol-d, 2-(methyl-d3)-(CAS 53001-22-2)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,1,1,3,3,3-hexadeuterio-2-deuteriooxy-2-(trideuteriomethyl)propane
DKGAVHZHDRPRBM-SGLLWXCUSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O[2H]
2-Propan-1,1,1,3,3,3-d6-ol-d, 2-(methyl-d3)- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.