This compound is a deuterium-labeled form of tert-butyl alcohol, where all nine hydrogen atoms in the methyl groups are replaced with deuterium. It is primarily used as a deuterated chemical intermediate in the synthesis of labeled compounds for pharmaceutical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Methyl-2-propan-d9-ol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Aminoguanidine bicarbonate
Pharmaceutical intermediate and research reagent
5-chloro-3,4-diazatricyclo[9.4.0.0,2,7]pentadeca-1(15),2(7),3,5,11,13-hexaene
pharmaceutical intermediate
3-cyano-4-isopropoxybenzoic acid
Pharmaceutical intermediate
2,6-Dichloropyridine N-oxide
pharmaceutical intermediate
2-Methylpropan-2-(2H)ol
Deuterated research reagent
2-Propan-1,1,1,3,3,3-d6-ol-d, 2-(methyl-d3)-
deuterated tert-butanol intermediate
Tert-Butanol
Solvent, denaturant, and gasoline additive
Zirconium(iv) t-butoxide
precursor for zirconium containing materials
1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-ol
DKGAVHZHDRPRBM-GQALSZNTSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O
2-Methyl-2-propan-d9-ol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.