(-)-2-chloromandelic acid is a chiral aromatic hydroxy acid used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients. Its structure features an aromatic ring substituted with chlorine and a chiral alcohol-acid moiety, making it valuable for preparing stereochemically defined drug compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(-)-2-chloromandelic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Carboxymethyl-5-Methoxy-Benzoic Acid
pharmaceutical intermediate
Ethyl 4-hydroxyquinoline-3-carboxylate
Pharmaceutical intermediate
ACETYLSALICYLSALICYLIC ACID
Aspirin related impurity standard
2-Propan-1,1,1,3,3,3-d6-ol-d, 2-(methyl-d3)-
deuterated tert-butanol intermediate
2-Chloromandelic acid
research compound
(-)-2-chloromandelic acid(CAS 52950-18-2)의 국제 HS 코드는 2918.19입니다.
2918.19
2918 19 98
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid
RWOLDZZTBNYTMS-SSDOTTSWSA-N
C1=CC=C(C(=C1)[C@H](C(=O)O)O)Cl
(-)-2-chloromandelic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.