2-Chloromandelic acid is a research compound containing a carboxylic acid and a hydroxyl group on a chlorinated aromatic ring. It is primarily used as a research reagent in chemical and pharmaceutical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Chloromandelic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
[(3S,5R)-5-(2,4-Difluorophenyl)tetrahydro-5-(iodomethyl)-3-furanyl]methyl 2-methylpropanoate
certified reference standard
3,4-Dihydroxybenzophenone
research compound
IRAK inhibitor 6
IRAK inhibitor research compound
O-Benzyl-D-serine
Research compound for peptide synthesis
(-)-2-chloromandelic acid
pharmaceutical intermediate
2-Chloromandelic acid(CAS 10421-85-9)의 국제 HS 코드는 2918.19입니다.
2918.19
2918 19 98
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2-(2-chlorophenyl)-2-hydroxyacetic acid
RWOLDZZTBNYTMS-UHFFFAOYSA-N
C1=CC=C(C(=C1)C(C(=O)O)O)Cl
2-Chloromandelic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.