Methyl O-tert-butyl-L-tyrosinate hydrochloride is a protected derivative of the amino acid tyrosine, commonly used in peptide synthesis. It features a tert-butyl ether protecting group on the phenolic oxygen and a methyl ester on the carboxyl group, supplied as a hydrochloride salt.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 51482-39-4
O-tert-Butyl-L-tyrosine
pharmaceutical intermediate for peptide synthesis
4-Hydroxy-3-pyridinesulfonic acid
Pharmaceutical intermediate for API synthesis
T-Boc-aminocaproic-N-hydroxysuccinimide
protected amino acid for peptide synthesis
H-Ser(tBu)-OtBu HCl
protected serine derivative for peptide synthesis
(R)-(-)-Epichlorohydrin
chiral intermediate for L-carnitine
methyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride
PAFVAMWJVIIMQK-YDALLXLXSA-N
CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)OC)N.Cl