t-Boc-aminocaproic-N-hydroxysuccinimide is a chemical compound used as a protected amino acid derivative in peptide synthesis. Its structure includes a tert-butoxycarbonyl (Boc) protecting group and an N-hydroxysuccinimide ester, making it suitable for coupling reactions in laboratory and industrial peptide manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
T-Boc-aminocaproic-N-hydroxysuccinimide 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-tert-Butyl 18-(2,5-dioxopyrrolidin-1-yl) octadecanedioate
research compound
1-tert-Butyl 20-(2,5-dioxopyrrolidin-1-yl) icosanedioate
research compound for PEGylation
N-alpha-t-Butyloxycarbonyl-N-alpha-methyl-L-isoleucine
protected amino acid for peptide synthesis
Boc-Asp(OcHx)-OH
protected amino acid for peptide synthesis
Boc-D-alanine
protected amino acid for peptide synthesis
Boc-l-lys(ivdde)-oh
protected amino acid for peptide synthesis
H-Ser(tBu)-OtBu HCl
protected serine derivative for peptide synthesis
(R)-(-)-Epichlorohydrin
chiral intermediate for L-carnitine
(2,5-dioxopyrrolidin-1-yl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate
TYJPSIQEEXOQLC-UHFFFAOYSA-N
CC(C)(C)OC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O
T-Boc-aminocaproic-N-hydroxysuccinimide 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.