H-Ser(tBu)-OtBu HCl is a protected serine derivative used as a building block in peptide synthesis. It is a salt-like compound featuring tert-butyl protecting groups on both the hydroxyl and carboxyl functions, commonly employed in research and pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 51537-21-4
(R)-(-)-Epichlorohydrin
chiral intermediate for L-carnitine
Methylmalonic acid
Pharmaceutical intermediate for API synthesis
3-Chloro-4-methylbenzoic acid
Pharmaceutical intermediate
3-Methyl-2-(4-chlorophenyl)butyryl chloride
Pharmaceutical intermediate
H-D-Ser(tBu)-OtBu.HCl
research compound
tert-butyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride
RDWZQVGVBTYCBD-QRPNPIFTSA-N
CC(C)(C)OC[C@@H](C(=O)OC(C)(C)C)N.Cl