H-D-Ser(tBu)-OtBu. HCl is a protected derivative of D-serine, commonly used as a research compound in peptide synthesis and pharmaceutical intermediate manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 179559-35-4
(+)-Menthofuran
Reference standard for analytical testing
Acyclovir-d4 L-Leucinate
isotopically labeled reference standard
3,7-dibromo-1,5-naphthyridine
research chemical
1,5-Naphthyridin-2-amine
research compound
H-Ser(tBu)-OtBu HCl
protected serine derivative for peptide synthesis
tert-butyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride
RDWZQVGVBTYCBD-DDWIOCJRSA-N
CC(C)(C)OC[C@H](C(=O)OC(C)(C)C)N.Cl