2-(Phenylcarbamoyl)benzoic acid is a chemical compound used as a pharmaceutical intermediate and research compound. Its structure features both carboxylic acid and amide functional groups, contributing to its role in organic synthesis and drug development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4727-29-1
1-ETHYL-1-(3,3,5-TRIMETHYLCYCLOHEXYL)PYRROLIDIN-1-IUM HYDROXIDE
structure directing agent
Dichloramine B
Disinfectant and antiseptic agent
Cyclopentyl isocyanate
Isocyanate reagent for synthesis
Ethoxalyl chloride
Acylating agent for organic synthesis
2-methyl-4-[(2-methylbenzoyl)amino]Benzoic acid
Tolvaptan intermediate
니클로사미드
active pharmaceutical ingredient
Benzoic acid, 4-(2-(octyloxy)benzamido)-, 2-(diethylamino)ethyl ester hydrochloride
pharmaceutical research compound
Otilonium Bromide
active pharmaceutical ingredient
2-(phenylcarbamoyl)benzoic acid
DSUPUOGOCIFZBG-UHFFFAOYSA-N
C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2C(=O)O