1-ethyl-1-(3,3,5-trimethylcyclohexyl)pyrrolidin-1-ium hydroxide is an industrial chemical that serves as a structure-directing agent. This quaternary ammonium compound is used in the synthesis of zeolites and other microporous materials to control their pore architecture.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,1-DIMETHYLPYRROLIDIN-1-IUM HYDROXIDE
structure directing agent
N,N-Diethyl-cis-2,6-dimethylpiperidiumhydroxide
structure directing agent
1,1,3,5-Tetramethylpiperidin-1-ium hydroxide
structure directing agent
Pyrrolidinium, 1,1-dimethyl-, chloride
structure directing agent
Dichloramine B
Disinfectant and antiseptic agent
Cyclopentyl isocyanate
Isocyanate reagent for synthesis
Ethoxalyl chloride
Acylating agent for organic synthesis
N-Methyl-o-phenylenediamine
chemical intermediate for dyes and pigments
1-ethyl-1-(3,3,5-trimethylcyclohexyl)pyrrolidin-1-ium hydroxide
PNRHGLOZFWHFPM-UHFFFAOYSA-M
CC[N+]1(CCCC1)C2CC(CC(C2)(C)C)C.[OH-]
—
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.