Dichloramine B is an This compound compound used primarily as a disinfectant and antiseptic agent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dichloramine B 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Chloramine-T trihydrate
Disinfectant and antiseptic agent
Iodine
Disinfectant and antiseptic agent
캐피털 레코드
Disinfectant and antiseptic agent
Cyclopentyl isocyanate
Isocyanate reagent for synthesis
Ethoxalyl chloride
Acylating agent for organic synthesis
N-Methyl-o-phenylenediamine
chemical intermediate for dyes and pigments
2,2-Bis(hydroxymethyl)propionic acid
Biodegradable polymer and coating intermediate
Dichloramine B(CAS 473-29-0)의 국제 HS 코드는 2935.90입니다.
2935.90
2935 90 90
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
N,N-dichlorobenzenesulfonamide
PJBJJXCZRAHMCK-UHFFFAOYSA-N
C1=CC=C(C=C1)S(=O)(=O)N(Cl)Cl
Dichloramine B 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.