Z-GLU(OME)-OH is a protected glutamic acid derivative used as a building block in peptide synthesis. Its structure includes a carbobenzyloxy (Cbz) protecting group on the amine and a methyl ester on the side chain carboxyl, making it suitable for solid-phase or solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Z-GLU(OME)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
5-(BENZYLOXY)-2-{[(BENZYLOXY)CARBONYL]AMINO}-5-OXOPENTANOIC ACID
Protected glutamic acid derivative
(2R)-2-{[(BENZYLOXY)CARBONYL]AMINO}PENTANEDIOIC ACID
pharmaceutical intermediate
N-Carbobenzoxy-L-glutamic acid
Research compound for peptide synthesis
5-tert-Butyl N-((phenylmethoxy)carbonyl)-L-glutamate
Protected amino acid for peptide synthesis
Cbz-alanine
peptide synthesis intermediate
N-Carbobenzoxy-L-aspartic acid
peptide synthesis intermediate
(2R)-5-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-oxopentanoic acid
peptide synthesis intermediate
Boc-D-Lys-OH
peptide synthesis intermediate
(2S)-5-methoxy-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid
JSNVOAWDAFVIKY-NSHDSACASA-N
COC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1
Z-GLU(OME)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.