Boc-D-Lys-OH is a protected derivative of D-lysine where the amino group is blocked by a tert-butoxycarbonyl (Boc) group, commonly used as a building block in solid-phase peptide synthesis. Its primary significance lies in enabling the incorporation of D-lysine residues into peptide chains during laboratory-scale and industrial peptide manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Boc-D-Lys-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2S)-4-amino-2-{[(tert-butoxy)carbonyl]amino}butanoic acid
Protected amino acid building block
BOC-D-DAB-OH
building block in peptide synthesis
Cbz-alanine
peptide synthesis intermediate
N-Carbobenzoxy-L-aspartic acid
peptide synthesis intermediate
(S)-22-(tert-Butoxycarbonyl)-45,45-dimethyl-10,19,24,43-tetraoxo-3,6,12,15,44-pentaoxa-9,18,23-triazahexatetracontanoic acid
peptide synthesis intermediate
(2S)-4-{[(tert-butoxy)carbonyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid
peptide synthesis intermediate
Acethydrazide
pharmaceutical intermediate
Diethyl acetamidomalonate
Pharmaceutical intermediate for flurbiprofen
(2R)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid
DQUHYEDEGRNAFO-MRVPVSSYSA-N
CC(C)(C)OC(=O)N[C@H](CCCCN)C(=O)O
Boc-D-Lys-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.