Diethyl acetamidomalonate is a chemical compound used as an intermediate in the synthesis of the pharmaceutical agent flurbiprofen. It is structurally characterized as an N-acetyl derivative of diethyl aminomalonate.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1068-90-2
(1S,9S)-t-butyl 9-amino-octahydro-10-oxo-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylate
Pharmaceutical intermediate for cilazapril
4,5-Desisopropylidene Topiramate
Topiramate impurity or intermediate
Divinyl glycol
crosslinking agent for polycarbophil polymer
2,2-Dimethyl-4,13-dioxo-3,8,11,17,20-pentaoxa-5,14-diazadocosan-22-oic acid
pharmaceutical intermediate for PEGylation
diethyl 2-acetamidopropanedioate
ISOLMABRZPQKOV-UHFFFAOYSA-N
CCOC(=O)C(C(=O)OCC)NC(=O)C