This compound is a protected derivative of D-glutamic acid, featuring an Fmoc group for temporary amine protection and tert-butyl ester groups for side-chain carboxyl protection. It is primarily employed as a building block in solid-phase peptide synthesis to introduce the D-glutamic acid residue.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Fmoc-Aad(otBu)-OH
Protected amino acid for peptide synthesis
Fmoc-Glu(OtBu)-Phe-OH
Peptide synthesis intermediate
Boc-D-Lys-OH
peptide synthesis intermediate
Cbz-alanine
peptide synthesis intermediate
N-Carbobenzoxy-L-aspartic acid
peptide synthesis intermediate
(S)-22-(tert-Butoxycarbonyl)-45,45-dimethyl-10,19,24,43-tetraoxo-3,6,12,15,44-pentaoxa-9,18,23-triazahexatetracontanoic acid
peptide synthesis intermediate
3,5-Diiodo-L-thyronine
Pharmaceutical intermediate for thyroid hormone
Tert-Butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate hemioxalate
Pharmaceutical intermediate
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid
OTKXCALUHMPIGM-HXUWFJFHSA-N
CC(C)(C)OC(=O)CC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.