Fmoc-Aad(otBu)-OH is a protected amino acid derivative used in solid-phase peptide synthesis. Its structure includes a fluorenylmethoxycarbonyl (Fmoc) protecting group and a tert-butyl ester on the side chain, enabling selective deprotection during peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 159751-47-0
Fmoc-L-Glu(OtBu)-OH monohydrate
protected amino acid for peptide synthesis
Fmoc-L-glutamic acid 5-tert-butyl ester
Protected amino acid for peptide synthesis
(2R)-5-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-oxopentanoic acid
peptide synthesis intermediate
4-tert-Butyl N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-aspartate
Peptide synthesis intermediate
Diamminediiodoplatinum
platinum-based pharmaceutical intermediate
(E)-2-cyano-3-morpholinoacrylamide
Pharmaceutical intermediate
Fmoc-Lys(Mmt)-OH
Fmoc-protected amino acid intermediate
(2S)-5-((aminocarbonyl)amino)-2-(((2S)-2-amino-3-methylbutanoyl)amino)-N-(4-(hydroxymethyl)phenyl)pentanamide
antibody-drug conjugate linker intermediate
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid
FFLAQPKWVSSKJC-NRFANRHFSA-N
CC(C)(C)OC(=O)CCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13