Fmoc-L-Glu(OtBu)-OH monohydrate is a protected amino acid derivative used as a building block in peptide synthesis. It features an Fmoc (fluorenylmethoxycarbonyl) protecting group on the amino group and a tert-butyl ester protecting the side-chain carboxyl group, with one molecule of water of hydration.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Fmoc-L-Glu(OtBu)-OH monohydrate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Fmoc-L-glutamic acid 5-tert-butyl ester
Protected amino acid for peptide synthesis
Fmoc-Aad(otBu)-OH
Protected amino acid for peptide synthesis
Fmoc-Glu(OtBu)-Phe-OH
Peptide synthesis intermediate
Benzyloxycarbonylasparagine
protected amino acid for peptide synthesis
Boc-Lys(Z)-OH
protected amino acid for peptide synthesis
Boc-L-serine
protected amino acid for peptide synthesis
Boc-His(Trt)-OH, Nalpha-Boc-N(im)-trityl-L-histidine
protected amino acid for peptide synthesis
Ethyl (1S,5R,6S)-5-(1-ethylpropoxy)-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate
Oseltamivir intermediate
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid;hydrate
NMBGBVUJSPZRDD-BDQAORGHSA-N
CC(C)(C)OC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13.O
Fmoc-L-Glu(OtBu)-OH monohydrate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.