Pivalic acid-d9 is a deuterated form of pivalic acid, where all nine hydrogen atoms on the three methyl groups are replaced with deuterium. It is primarily used as a deuterated reference standard in analytical chemistry and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 42983-07-3
3,4-DIMETHOXYPHENYLACETIC-2,2-D2 ACID
deuterated reference standard
Cholic Acid-d5
deuterated reference standard
4-NITROANILINE-2,3,5,6-D4
deuterated reference standard
Benzyl-2,3,4,5,6-d5 alcohol
deuterated reference standard
L-Tryptophan benzyl ester
Research reagent for biochemical studies
Ethynylmagnesium Bromide
Grignard reagent for organic synthesis
4-ethynyl-1,2-dimethoxybenzene
research compound
Diethyl malonate-d2
reference standard for organic synthesis
3,3,3-trideuterio-2,2-bis(trideuteriomethyl)propanoic acid
IUGYQRQAERSCNH-GQALSZNTSA-N
[2H]C([2H])([2H])C(C(=O)O)(C([2H])([2H])[2H])C([2H])([2H])[2H]