Diethyl malonate-d2 is a deuterium-labeled derivative of diethyl malonate, used primarily as a reference standard in organic synthesis. Its incorporation of two deuterium atoms at the methylene position makes it valuable for isotopic labeling studies and mechanistic investigations in chemical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4303-49-5
Methyl D-prolinate
research compound
(R)-3-Phenylpiperidine
research compound
4-Phenyl-1,2,3,6-tetrahydropyridine hydrochloride
pharmaceutical intermediate
4'-tert-Butyl-4-chlorobutyrophenone
research intermediate for butyrophenone derivatives
DIETHYL MALONATE
Pharmaceutical intermediate for barbiturates
diethyl 2,2-dideuteriopropanedioate
IYXGSMUGOJNHAZ-BFWBPSQCSA-N
[2H]C([2H])(C(=O)OCC)C(=O)OCC