Cholic Acid-d5 is a deuterated reference standard, a pentadeuterio-labeled form of cholic acid used in analytical chemistry. Its primary significance lies in serving as an internal standard for mass spectrometry and other quantitative assays, enabling accurate measurement of cholic acid levels in biological or pharmaceutical samples.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Cholic Acid-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
17ALPHA-ESTRADIOL-2,4-D2
deuterated reference standard
4-NITROANILINE-2,3,5,6-D4
deuterated reference standard
Benzyl-2,3,4,5,6-d5 alcohol
deuterated reference standard
4-CHLOROTOLUENE-D7
deuterated reference standard
Sodium 3,5-difluorobenzoate
Chemical research reagent
T-5224
c-Fos/AP-1 inhibitor research compound
Iodomethyl pivalate
iodinated ester research reagent
2,3,4,6-Tetra-O-benzyl-D-galactose
Research compound for carbohydrate chemistry
(4R)-4-[(3R,5S,10S,12S,13R,14S,17R)-2,2,3,4,4-pentadeuterio-3,7,12-trihydroxy-10,13-dimethyl-1,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid
BHQCQFFYRZLCQQ-QBERNLAISA-N
[2H][C@]1(C(C[C@]2([C@@H](C1([2H])[2H])CC(C3C2C[C@@H]([C@]4([C@H]3CC[C@@H]4[C@H](C)CCC(=O)O)C)O)O)C)([2H])[2H])O
Cholic Acid-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.