Cholic Acid-d5 is a deuterated reference standard, a pentadeuterio-labeled form of cholic acid used in analytical chemistry. Its primary significance lies in serving as an internal standard for mass spectrometry and other quantitative assays, enabling accurate measurement of cholic acid levels in biological or pharmaceutical samples.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 53007-09-3
17ALPHA-ESTRADIOL-2,4-D2
deuterated reference standard
4-NITROANILINE-2,3,5,6-D4
deuterated reference standard
Benzyl-2,3,4,5,6-d5 alcohol
deuterated reference standard
4-CHLOROTOLUENE-D7
deuterated reference standard
Sodium 3,5-difluorobenzoate
Chemical research reagent
T-5224
c-Fos/AP-1 inhibitor research compound
Iodomethyl pivalate
iodinated ester research reagent
2,3,4,6-Tetra-O-benzyl-D-galactose
Research compound for carbohydrate chemistry
(4R)-4-[(3R,5S,10S,12S,13R,14S,17R)-2,2,3,4,4-pentadeuterio-3,7,12-trihydroxy-10,13-dimethyl-1,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid
BHQCQFFYRZLCQQ-QBERNLAISA-N
[2H][C@]1(C(C[C@]2([C@@H](C1([2H])[2H])CC(C3C2C[C@@H]([C@]4([C@H]3CC[C@@H]4[C@H](C)CCC(=O)O)C)O)O)C)([2H])[2H])O