T-5224 is a small-molecule research compound that acts as an inhibitor of c-Fos/activator protein 1 (AP-1). It was originally investigated for potential use in rheumatoid arthritis but was never marketed, and is now primarily used in laboratory research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 530141-72-1
Iodomethyl pivalate
iodinated ester research reagent
2,3,4,6-Tetra-O-benzyl-D-galactose
Research compound for carbohydrate chemistry
Equol
Pharmaceutical research metabolite reference standard
2-Methylisothiouronium chloride
research compound
3-[5-(4-cyclopentyloxy-2-hydroxybenzoyl)-2-[(3-oxo-1,2-benzoxazol-6-yl)methoxy]phenyl]propanoic acid
DALCQQSLNPLQFZ-UHFFFAOYSA-N
C1CCC(C1)OC2=CC(=C(C=C2)C(=O)C3=CC(=C(C=C3)OCC4=CC5=C(C=C4)C(=O)NO5)CCC(=O)O)O