This compound is a deuterium-labeled form of isopropanol used as an internal standard in NMR spectroscopy. Its primary significance lies in providing a stable reference signal for quantitative nuclear magnetic resonance analysis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Propanol-1,1,1,3,3,3-d6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-amino-6-methylpyrimidin-4-one
biochemical precursor to thiamine pyrophosphate
Dimethyl 2,3-difluoromaleate
specialty chemical intermediate
6-phenylpyridin-2-amine
research compound
N-Formyl-L-kynurenine
tryptophan catabolism intermediate
Propan-2-(2H)ol
deuterated research reagent
아이소프로필 알코올
solvent and disinfectant
2-Propanol-d7
deuterated reference standard
(O,1,1,1,2,3,3,3-2H8)Propan-2-ol
deuterated research reference standard
2-Propanol-1,1,1,3,3,3-d6(CAS 3976-29-2)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,1,1,3,3,3-hexadeuteriopropan-2-ol
KFZMGEQAYNKOFK-WFGJKAKNSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])O
2-Propanol-1,1,1,3,3,3-d6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.