Dimethyl 2,3-difluoromaleate is a fluorinated organic compound used as a specialty chemical intermediate for research and laboratory-scale synthesis. It features two ester groups and two fluorine atoms on a double-bonded carbon backbone, giving it distinct reactivity for organic chemistry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dimethyl 2,3-difluoromaleate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
6-phenylpyridin-2-amine
research compound
N-Formyl-L-kynurenine
tryptophan catabolism intermediate
Propan-2-(2H)ol
deuterated research reagent
4-Ethynyl-1-methyl-1H-pyrazole
Research compound for organic synthesis
Dimethyl 2,3-difluorofumarate
Pharmaceutical intermediate
dimethyl (Z)-2,3-difluorobut-2-enedioate
ZDGDBABNSVPXFK-ARJAWSKDSA-N
COC(=O)/C(=C(\C(=O)OC)/F)/F
Dimethyl 2,3-difluoromaleate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.