Dimethyl 2,3-difluorofumarate is a fluorinated organic compound used as a pharmaceutical intermediate. Its structure features two ester groups and two fluorine atoms attached to a carbon-carbon double bond.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dimethyl 2,3-difluorofumarate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(6R,7R)-7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Pharmaceutical intermediate for cephalosporin antibiotics
Methyl 4-(3-amino-3-methylbutyl)benzoate
pharmaceutical intermediate
Rel-(2R)-6-Fluoro-3,4-dihydro-2-((2S)-2-oxiranyl)-2H-1-benzopyran
Pharmaceutical intermediate
Cefixime EP Impurity F
Cefixime impurity reference standard
Dimethyl 2,3-difluoromaleate
specialty chemical intermediate
dimethyl (E)-2,3-difluorobut-2-enedioate
ZDGDBABNSVPXFK-ONEGZZNKSA-N
COC(=O)/C(=C(/C(=O)OC)\F)/F
Dimethyl 2,3-difluorofumarate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.