2-Propanol-d7 is a deuterated form of isopropanol where all seven hydrogen atoms are replaced with deuterium. It is primarily used as a deuterated reference standard in analytical chemistry and research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Propanol-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-Hexan-d13-ol
deuterated reference standard
Perdeuteroadamantane
deuterated reference standard
Perylene, perdeutero-
deuterated reference standard
4-BROMOPHENOL-2,3,5,6-D4
deuterated reference standard
1-IODOTETRADECANE
Research chemical and synthetic intermediate
Isoquinoline-4-boronic acid
research compound for organic synthesis
(3-Phenylnaphthalen-1-yl)boronic acid
Boronic acid research compound
(Perfluoro-[2,2'-bithiophene]-5,5'-diyl)bis(trimethylstannane)
research compound for organic electronics
1,1,1,2,3,3,3-heptadeuteriopropan-2-ol
KFZMGEQAYNKOFK-YYWVXINBSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])O
2-Propanol-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.