Perdeuteroadamantane is a fully deuterated derivative of adamantane used as a deuterated reference standard in analytical chemistry. Its high isotopic purity makes it valuable for nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry applications where deuterium labeling is required.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Perdeuteroadamantane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-amino-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid
deuterated reference standard
Pivalic acid-d9
deuterated reference standard
Cholic Acid-d5
deuterated reference standard
4-NITROANILINE-2,3,5,6-D4
deuterated reference standard
Sodium iodoacetate
enzyme inhibitor in biochemical research
N-nitroso-desmethyl-tetracaine
Nitrosamine impurity reference standard
4-Amino-5-chloro-2,1,3-benzothiadiazole
research compound
S-Acetylglutathione
research compound
Perdeuteroadamantane(CAS 30470-60-1)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-hexadecadeuterioadamantane
ORILYTVJVMAKLC-QJESCHDLSA-N
[2H]C1(C2(C(C3(C(C1(C(C(C2([2H])[2H])(C3([2H])[2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H])[2H]
Perdeuteroadamantane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.