Hexadecanoic-d31 acid is a deuterated form of palmitic acid, a C16 straight-chain saturated fatty acid in which the aliphatic hydrogen atoms have been replaced by deuterium. It is primarily used as a reference standard in analytical chemistry for the quantification and identification of fatty acids by mass spectrometry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 39756-30-4
Eicosanoic-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-d39 acid
Deuterated fatty acid for research
Dodecanoic-d23 acid
isotopically labeled research reference standard
Undecanoic acid-d21
deuterated fatty acid research reagent
Tetradecanoic-d27 acid
Deuterated fatty acid standard
2-Propanol-1,1,1,3,3,3-d6
Deuterated internal standard for NMR
2-amino-6-methylpyrimidin-4-one
biochemical precursor to thiamine pyrophosphate
Dimethyl 2,3-difluoromaleate
specialty chemical intermediate
6-phenylpyridin-2-amine
research compound
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-hentriacontadeuteriohexadecanoic acid
IPCSVZSSVZVIGE-SAQPIRCFSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O