This compound is a peptide synthesis reagent that features a fluorenylmethoxycarbonyl (Fmoc) protecting group. It is valued in organic synthesis for its stability toward acids and hydrolysis, with selective removal by weak bases such as piperidine, facilitating efficient solid-phase peptide synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)glycylglycylglycine
research compound for peptide synthesis
Fmoc-Gly-OH
Fmoc-protected amino acid for peptide synthesis
2-{2-[3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]acetamido}acetic acid
research compound for peptide synthesis
N-Carbobenzyloxy-L-valine
peptide synthesis reagent
4-iodo-3-nitrobenzoic acid
research compound
N-Cbz-L-homoserine lactone
peptide synthesis intermediate
3,6-difluoropyrazine-2-carbonitrile
Research compound
6-FLUORO-3,4-DIHYDRO-3-OXO-2-PYRAZINECARBONITRILE
research compound
2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetic acid
FBKUOPULLUJMOC-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)NCC(=O)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.