Fmoc-Gly-OH is an Fmoc-protected glycine derivative widely used as a building block in solid-phase peptide synthesis. Its fluorenylmethoxycarbonyl (Fmoc) group provides temporary protection for the amino group, enabling sequential assembly of peptides.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 29022-11-5
2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)acetamido)acetic acid
peptide synthesis reagent
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)glycylglycylglycine
research compound for peptide synthesis
2-{2-[3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]acetamido}acetic acid
research compound for peptide synthesis
Fmoc-L-asparagine
Fmoc-protected amino acid for peptide synthesis
Fmoc-Ala-OH H2O
Fmoc-protected amino acid for peptide synthesis
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-methionine
Fmoc-protected amino acid for peptide synthesis
FMoc-alpha-Me-D-Phe(2-F)-OH
Fmoc-protected amino acid for peptide synthesis
(2-Butyl-3-benzofuranyl)(4-ethoxy-3,5-diiodophenyl)methanone
Amiodarone impurity reference standard
2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid
NDKDFTQNXLHCGO-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)O