4-Iodo-3-nitrobenzoic acid is a chemical compound featuring a benzene ring substituted with an iodine atom, a nitro group, and a carboxylic acid group. It is primarily used as a research reagent in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-iodo-3-nitrobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-Cbz-L-homoserine lactone
peptide synthesis intermediate
3,6-difluoropyrazine-2-carbonitrile
Research compound
6-FLUORO-3,4-DIHYDRO-3-OXO-2-PYRAZINECARBONITRILE
research compound
N-(Hydroxymethyl)nicotinamide
research compound
4-iodo-3-nitrobenzoic acid
DNMTZLCNLAIKQC-UHFFFAOYSA-N
C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])I
4-iodo-3-nitrobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.