FMOC-PHE (Fmoc-phenylalanine) is an Fmoc-protected amino acid used primarily as a research reagent for the formation of hydrogels. Its self-assembly properties enable the creation of structured peptide-based gel networks in aqueous conditions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 35661-40-6
FMOC-PHE(4-NH2)-OH
Peptide building block intermediate
(s)-n-fmoc-4-chlorophenylalanine
Pharmaceutical intermediate for peptide synthesis
FMOC-PHE(4-BR)-OH
Research compound for peptide synthesis
2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)acetamido)acetic acid
peptide synthesis reagent
4-iodo-3-nitrobenzoic acid
research compound
N-Cbz-L-homoserine lactone
peptide synthesis intermediate
3,6-difluoropyrazine-2-carbonitrile
Research compound
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-phenylpropanoic acid
Fmoc-protected amino acid reagent
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid
SJVFAHZPLIXNDH-QFIPXVFZSA-N
C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24