4-Nitrodiphenyl-d9 is a deuterated research compound, specifically a fully deuterated form of 4-nitrodiphenyl where all nine hydrogen atoms on the biphenyl rings are replaced by deuterium. It is primarily used as a stable isotope-labeled internal standard or reference material in analytical chemistry and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-NITRODIPHENYL-D9 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Nitro(2H5)benzene
NMR solvent
1,2,3,4-TETRAMETHYLBENZENE-D14
deuterated internal standard
1,2,4-TRIMETHYLBENZENE-D12
stable isotope labeled research compound
2,3-Dimethylpyridine-d9
Deuterated research compound
(Rac)-Cotinine-d4
isotopically labeled analytical reference standard
1,2,3,4,5-pentadeuterio-6-(2,3,5,6-tetradeuterio-4-nitrophenyl)benzene
BAJQRLZAPXASRD-LOIXRAQWSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])[N+](=O)[O-])[2H])[2H])[2H])[2H]
4-NITRODIPHENYL-D9 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.