This compound is a deuterium-labeled derivative of decanedioic acid, specifically bearing four deuterium atoms at the 2,2,9,9 positions. It is primarily used as a research reagent for analytical and synthetic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,10-DECANEDIOIC-2,2,9,9-D4 ACID 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Hexadecanoic-2,2-d2 acid
isotopically labeled fatty acid
EICOSANOIC-2,2-D2 ACID
deuterated fatty acid research standard
Methyl 3-bromopropanoate
Research reagent
((3aR,5S,6aR)-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanol
research compound
Ethyl trans-4-hydroxy-L-prolinate hydrochloride
research compound
4-Acetamidobenzaldehyde
research reagent
1,10-DECANEDIOIC-D16 ACID
Deuterated analytical reference standard
Sebacic acid
paint pigment binder and lubricating agent
2,2,9,9-tetradeuteriodecanedioic acid
CXMXRPHRNRROMY-OSEHSPPNSA-N
[2H]C([2H])(CCCCCCC([2H])([2H])C(=O)O)C(=O)O
1,10-DECANEDIOIC-2,2,9,9-D4 ACID 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.