Ethyl trans-4-hydroxy-L-prolinate hydrochloride is a salt-form research compound that serves as a protected derivative of 4-hydroxy-L-proline. Its significance lies in its use as a laboratory reagent for peptide synthesis and biochemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 33996-30-4
4-Acetamidobenzaldehyde
research reagent
Methyl 2-[(2R)-pyrrolidin-2-yl]acetate hydrochloride
research compound
1,1,2,2,3,3,4,5,5,6-decadeuterio-4,6-dimethoxycyclohexane
deuterated research compound
Tryptamine-d4 Hydrochloride
labeled research reference standard
ethyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride
HHXSZDXMSRXWJV-IBTYICNHSA-N
CCOC(=O)[C@@H]1C[C@H](CN1)O.Cl