This compound is a deuterated research compound, specifically a decadeuterated dimethoxycyclohexane derivative. It is primarily used as a labeled reagent in laboratory research, where the incorporation of deuterium atoms facilitates studies in metabolic tracing and analytical chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 340257-57-0
Tryptamine-d4 Hydrochloride
labeled research reference standard
3-Methyl-5-isoxazolecarboxylic acid
research compound
Oxazole, 2,2'-(1,3-phenylene)bis[4,5-dihydro-
chemical research intermediate
(S)-1-N-Cbz-prolinamide
Protected proline derivative for peptide synthesis
1,1,2,2,3,3,4,5,5,6-decadeuterio-4,6-dimethoxycyclohexane
MQTLTQMOALIWRO-UPEVGZBISA-N
[2H]C1(C(C(C(C(C1([2H])[2H])([2H])OC)([2H])[2H])([2H])OC)([2H])[2H])[2H]
—