D-Arabinoic acid sodium salt is the sodium salt form of arabinoic acid, a sugar acid derivative. It is primarily used as a research reagent in biochemical and chemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
D-Arabinoic acid sodium salt 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Azanium;2,3,4,5,6-pentahydroxyhexanoate
food additive
Calcium gluconolactate
calcium supplement
Iron(2+);2,3,4,5,6-pentahydroxyhexanoate;dihydrate
iron supplementation
Copper D-gluconate
mineral supplement
3-Aminophenylboronic acid
research compound
8-Methyl-7H-purin-6-ol
research compound
Perdeuteroadamantane
deuterated reference standard
Sodium iodoacetate
enzyme inhibitor in biochemical research
sodium 2,3,4,5-tetrahydroxypentanoate
IDBPBTCQINMQJK-UHFFFAOYSA-M
C(C(C(C(C(=O)[O-])O)O)O)O.[Na+]
D-Arabinoic acid sodium salt 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.