This compound is a deuterium-labeled research reagent, specifically a hexadeuterated derivative of a dithiol diol. Its primary significance lies in its use as an isotopically labeled compound for analytical and research applications, where the incorporation of deuterium enables tracing and quantification in mass spectrometry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 302912-05-6
L-Aspartic acid-2,3,3-d3
isotopically labeled research reagent
2-Methylalanine-d6
isotopically labeled research reagent
(13C)-Methane
isotopically labeled research reagent
Dimethylamine-15N hydrochloride
isotopically labeled research reagent
2-AMINO-N-(2-CHLORO-6-METHYLPHENYL)THIAZOLE-5-CARBOXAMIDE
research compound
(Z)-1-(2-((4-(((6-(methoxycarbonyl)-2-oxoindolin-3-ylidene)(phenyl)methyl)amino)phenyl)(methyl)amino)-2-oxoethyl)-4-methylpiperazine 1-oxide
research compound
Intedanib Piperazinyl-N4-oxide
N-oxide metabolite reference standard
2,6-DIHYDROXYBENZOIC ACID
MALDI matrix compound
1,1,2,3,4,4-hexadeuterio-2,3-dideuteriooxy-1,4-bis(deuteriosulfanyl)butane
VHJLVAABSRFDPM-BSSDICLPSA-N
[2H]C([2H])(C([2H])(C([2H])(C([2H])([2H])S[2H])O[2H])O[2H])S[2H]