2,6-Dihydroxybenzoic acid is a dihydroxybenzoic acid derivative commonly employed as a matrix compound in matrix-assisted laser desorption/ionization (MALDI) mass spectrometry for the analysis of various analytes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 303-07-1
2',6'-Dihydroxyacetophenone
MALDI matrix compound
3-Nitrobenzyl alcohol
MALDI matrix compound
Coenzyme Q9
antioxidant and human metabolite
(R)-1-nitrosopiperidin-3-amine
analytical reference standard for nitrosamine impurities
2-ethyl-2-adamantyl acrylate
research compound
5-(Adamantan-1-yl)-[1,1'-biphenyl]-2-amine
research compound
2,6-dihydroxybenzoic acid
AKEUNCKRJATALU-UHFFFAOYSA-N
C1=CC(=C(C(=C1)O)C(=O)O)O