L-Aspartic acid-2,3,3-d3 is a deuterium-labeled form of the amino acid L-aspartic acid, where three hydrogen atoms are replaced with deuterium. It is primarily used as an isotopically labeled research reagent in biochemical and analytical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 3842-25-9
DL-Aspartic acid-d3
deuterated amino acid research reagent
Propanoic acid-2,2-d2
isotopically labeled research reagent
2-Methylalanine-d6
isotopically labeled research reagent
(13C)-Methane
isotopically labeled research reagent
Dimethylamine-15N hydrochloride
isotopically labeled research reagent
D-Pipercolic acid HCl
research compound
Cy-vBRIDP
phosphine ligand for homogeneous catalysis
Bis(1,1-dimethylethyl)(1-methyl-2,2-diphenylethenyl)phosphine
phosphine ligand for catalysis
(2S)-2-amino-2,3,3-trideuteriobutanedioic acid
CKLJMWTZIZZHCS-RBXBQAPRSA-N
[2H][C@@](C(=O)O)(C([2H])([2H])C(=O)O)N