Cy-vBRIDP is a phosphine ligand featuring a dicyclohexylphosphino group attached to a 1,1-diphenylprop-1-en-2-yl fragment. It is primarily used as a ligand in homogeneous catalysis to coordinate with metal centers and influence reaction selectivity and activity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Cy-vBRIDP 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Bis(1,1-dimethylethyl)(1-methyl-2,2-diphenylethenyl)phosphine
phosphine ligand for catalysis
2-Amino-4-chlorobenzonitrile
research reagent for synthesis
2-Fluoro-6-nitrobenzoic acid
research compound
Methylamine-15N hydrochloride
Isotopically labeled research compound
dicyclohexyl(1,1-diphenylprop-1-en-2-yl)phosphane
YMSBPYCREGBACF-UHFFFAOYSA-N
CC(=C(C1=CC=CC=C1)C2=CC=CC=C2)P(C3CCCCC3)C4CCCCC4
Cy-vBRIDP 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.