2-Fluoro-6-nitrobenzoic acid is a research compound with a structure featuring a carboxylic acid group, a fluorine atom, and a nitro group on an aromatic ring. Its physicochemical profile suggests moderate lipophilicity and a single hydrogen bond donor, indicating potential as a building block in synthetic chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Fluoro-6-nitrobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methylamine-15N hydrochloride
Isotopically labeled research compound
2-Mercaptopyrazine
research compound
(1,2,3,4,5,6,7,8-2H8)-9H-carbazole
isotope-labeled research compound
2-NITRODIPHENYL-D9
deuterated analytical reference standard
2-fluoro-6-nitrobenzoic acid
MPDZCNPDHUUPRL-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)C(=O)O)[N+](=O)[O-]
2-Fluoro-6-nitrobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.