2-Amino-4'-chlorobenzophenone is an organic compound that serves as a pharmaceutical intermediate. Its structure consists of an aminophenyl group and a chlorophenyl group linked by a ketone moiety, giving it moderate lipophilicity and a polar surface area suitable for synthetic transformations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2894-51-1
8-benzyl-8-azabicyclo[3.2.1]octan-3-one
pharmaceutical intermediate for tropane derivatives
2-(3,5-bis(trifluoromethyl)phenyl)-2-methylpropanoic acid
Pharmaceutical intermediate for netupitant synthesis
L-Methionine ethyl ester hydrochloride
Pharmaceutical intermediate
Fmoc-Gly-OH
Fmoc-protected amino acid for peptide synthesis
(2-aminophenyl)-(4-chlorophenyl)methanone
APHLSUBLNQBFTM-UHFFFAOYSA-N
C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)N