This compound is a carboxylic acid derivative featuring two trifluoromethyl groups on an aromatic ring. It serves as a pharmaceutical intermediate, primarily used in the manufacturing process for the active pharmaceutical ingredient netupitant.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 289686-70-0
L-Methionine ethyl ester hydrochloride
Pharmaceutical intermediate
Fmoc-Gly-OH
Fmoc-protected amino acid for peptide synthesis
(2-Butyl-3-benzofuranyl)(4-ethoxy-3,5-diiodophenyl)methanone
Amiodarone impurity reference standard
3,5-Bis(trifluoromethyl)-alpha,N-dimethylbenzylamine
Pharmaceutical intermediate for research synthesis
2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoic acid
ORLKRFYFNMCQIG-UHFFFAOYSA-N
CC(C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C(=O)O