4-Bromo-2,5-difluorobenzoic acid is a halogenated benzoic acid derivative commonly utilized as a research reagent in chemical and pharmaceutical development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-bromo-2,5-difluorobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Bromo-4,5-difluorobenzoic acid
chemical synthesis intermediate
5-Hydroxy-1-tetralone
reagent for glucose determination
2-Bromo-9,9-dimethylfluorene
Organic synthesis reagent
Sulfur trioxide-pyridine
sulfonation and sulfation reagent
S-Trifluoromethyl-2,8-bis(trifluoromethoxy)dibenzothiophenium Triflate
research reagent for organic synthesis
4-bromo-2,5-difluorobenzoic acid
YWZSTHLOAZTDFJ-UHFFFAOYSA-N
C1=C(C(=CC(=C1F)Br)F)C(=O)O
—
4-bromo-2,5-difluorobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.