2-Bromo-9,9-dimethylfluorene is a brominated derivative of dimethylfluorene used as an organic synthesis reagent, particularly in the preparation of advanced materials and organic electronics. Its structure features a bromine atom on the aromatic ring, contributing to its utility in cross-coupling reactions for constructing complex molecular architectures.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Bromo-9,9-dimethylfluorene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-bromo-9,9-dimethyl-9H-fluorene
OLED material intermediate
4-IODOPHENOL
Organic synthesis reagent
3-Nitrobenzyl bromide
Organic synthesis reagent
Glyoxylic acid monohydrate
Organic synthesis reagent
Ethyl propiolate
Organic synthesis reagent
Sulfur trioxide-pyridine
sulfonation and sulfation reagent
S-Trifluoromethyl-2,8-bis(trifluoromethoxy)dibenzothiophenium Triflate
research reagent for organic synthesis
11-BROMOUNDECANOIC ACID
biochemical research reagent
2-bromo-9,9-dimethylfluorene
MBHPOBSZPYEADG-UHFFFAOYSA-N
CC1(C2=CC=CC=C2C3=C1C=C(C=C3)Br)C
2-Bromo-9,9-dimethylfluorene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.