2-Bromo-4,5-difluorobenzoic acid is a halogenated aromatic carboxylic acid commonly used as a chemical synthesis intermediate. It is typically employed in laboratory and research settings for the preparation of more complex organic molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 64695-84-7
4-bromo-2,5-difluorobenzoic acid
research compound
1-(4-(trifluoromethyl)phenyl)propan-2-one
chemical synthesis intermediate
Methyl 2-Chloro-3-methylbenzoate
chemical synthesis intermediate
2-bromo-5-(trifluoromethyl)phenol
chemical synthesis intermediate
4-Cyanophenyl isocyanate
chemical synthesis intermediate
Triisopropylphosphine
Ligand in organometallic chemistry
3,4-Dimethoxyamphetamine, (R)-
research compound
Quinoline-3-carboxylic acid
research compound
2-bromo-4,5-difluorobenzoic acid
DGCBGBZYTNTZJH-UHFFFAOYSA-N
C1=C(C(=CC(=C1F)F)Br)C(=O)O
—