2,4,6-Trifluorobenzoic acid is a fluorinated aromatic carboxylic acid used as a research reagent. Its crystal structure has been reported in the scientific literature, highlighting its role in structural chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 28314-80-9
4-bromo-2,5-difluorobenzoic acid
research compound
5-Hydroxy-1-tetralone
reagent for glucose determination
2-Bromo-9,9-dimethylfluorene
Organic synthesis reagent
Sulfur trioxide-pyridine
sulfonation and sulfation reagent
2,4,6-trifluorobenzoic acid
SJZATRRXUILGHH-UHFFFAOYSA-N
C1=C(C=C(C(=C1F)C(=O)O)F)F